CAS 855715-35-4

Thieno[2′,3′:4,5]imidazo[1,2-a]pyridine-2-carboxylic acid

Description:

Thieno[2′,3′:4,5]imidazo[1,2-a]pyridine-2-carboxylic acid is a heterocyclic compound characterized by its unique fused ring structure, which incorporates both thieno and imidazo moieties along with a pyridine ring. This compound typically exhibits properties associated with heterocycles, such as potential biological activity and the ability to participate in various chemical reactions. The presence of the carboxylic acid functional group contributes to its acidity and can influence its solubility and reactivity. Additionally, compounds of this type may exhibit pharmacological properties, making them of interest in medicinal chemistry. The structural complexity allows for diverse interactions with biological targets, which can be explored for therapeutic applications. Its CAS number, 855715-35-4, serves as a unique identifier for this specific chemical, facilitating its identification in scientific literature and databases. Overall, thieno[2′,3′:4,5]imidazo[1,2-a]pyridine-2-carboxylic acid represents a class of compounds with significant potential in research and development.

Formula: C₁₀H₆N₂O₂S

InChI: InChI=1S/C10H6N2O2S/c13-10(14)7-5-6-9(15-7)11-8-3-1-2-4-12(6)8/h1-5H,(H,13,14)

InChI key: InChIKey=DZJHCXAWQGHBST-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=CC=2N3C(=NC2S1)C=CC=C3

Synonyms:

• Thieno[2′,3′:4,5]imidazo[1,2-a]pyridine-2-carboxylic acid

5-Thia-1,7-diazatricyclo[6.4.0.0,2,6]dodeca-2(6),3,7,9,11-pentaene-4-carboxylic acid

CAS: 855715-35-4

Versatile small molecule scaffold

Formula: C₁₀H₆N₂O₂S

Purity: Min. 95%

Molecular weight: 218.23 g/mol

Ref: 3D-FJB71535