CymitQuimica logo

CAS 855715-44-5

:

2-Chloro-N-[1-(2,4,5-trimethylphenyl)ethyl]acetamide

Description:
2-Chloro-N-[1-(2,4,5-trimethylphenyl)ethyl]acetamide is a chemical compound characterized by its unique structure, which includes a chloro group and an acetamide functional group. This compound features a substituted phenyl ring, specifically a 2,4,5-trimethylphenyl moiety, which contributes to its hydrophobic characteristics and potential biological activity. The presence of the chloro substituent enhances its reactivity and may influence its interaction with biological targets. Typically, compounds of this nature are studied for their potential applications in pharmaceuticals or agrochemicals due to their ability to modulate biological pathways. The molecular structure suggests that it may exhibit specific binding affinities or inhibitory effects, making it of interest in medicinal chemistry. Additionally, the compound's solubility, stability, and reactivity can vary based on environmental conditions, which are crucial for its practical applications. Safety and handling precautions are essential when working with this compound, as with many halogenated organic substances, due to potential toxicity and environmental impact.
Formula:C13H18ClNO
InChI:InChI=1S/C13H18ClNO/c1-8-5-10(3)12(6-9(8)2)11(4)15-13(16)7-14/h5-6,11H,7H2,1-4H3,(H,15,16)
InChI key:InChIKey=KSHQLJZWJYBUDH-UHFFFAOYSA-N
SMILES:C(NC(CCl)=O)(C)C1=C(C)C=C(C)C(C)=C1
Synonyms:
  • Acetamide, 2-chloro-N-[1-(2,4,5-trimethylphenyl)ethyl]-
  • 2-Chloro-N-[1-(2,4,5-trimethylphenyl)ethyl]acetamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.