CAS 855763-77-8
:Ethyl 2-methylquinoline-6-carboxylate
Description:
Ethyl 2-methylquinoline-6-carboxylate is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. This compound features an ethyl ester functional group, contributing to its reactivity and solubility properties. The presence of a methyl group at the 2-position and a carboxylate group at the 6-position of the quinoline ring influences its chemical behavior, making it a potential candidate for various applications in organic synthesis and medicinal chemistry. Ethyl 2-methylquinoline-6-carboxylate may exhibit biological activity, which can be explored for pharmaceutical purposes. Its molecular structure allows for potential interactions with biological targets, making it of interest in drug development. Additionally, the compound's physical properties, such as boiling point, melting point, and solubility, are influenced by its functional groups and overall molecular architecture. As with many organic compounds, safety and handling precautions should be observed, particularly in laboratory settings, due to potential toxicity or reactivity.
Formula:C13H13NO2
InChI:InChI=1/C13H13NO2/c1-3-16-13(15)11-6-7-12-10(8-11)5-4-9(2)14-12/h4-8H,3H2,1-2H3
SMILES:CCOC(=O)c1ccc2c(ccc(C)n2)c1
Synonyms:- 6-Quinolinecarboxylic Acid, 2-Methyl-, Ethyl Ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Ethyl 2-methylquinoline-6-carboxylate, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C13H13NO2Purity:97%Molecular weight:215.25ETHYL 2-METHYLQUINOLINE-6-CARBOXYLATE
CAS:Formula:C13H13NO2Purity:97%Color and Shape:SolidMolecular weight:215.2478Ethyl 2-methylquinoline-6-carboxylate
CAS:Ethyl 2-methylquinoline-6-carboxylatePurity:97%Molecular weight:215.25g/molEthyl 2-methylquinoline-6-carboxylate
CAS:Formula:C13H13NO2Purity:95.0%Color and Shape:SolidMolecular weight:215.252



