CAS 855763-77-8

Ethyl 2-methylquinoline-6-carboxylate

Description:

Ethyl 2-methylquinoline-6-carboxylate is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. This compound features an ethyl ester functional group, contributing to its reactivity and solubility properties. The presence of a methyl group at the 2-position and a carboxylate group at the 6-position of the quinoline ring influences its chemical behavior, making it a potential candidate for various applications in organic synthesis and medicinal chemistry. Ethyl 2-methylquinoline-6-carboxylate may exhibit biological activity, which can be explored for pharmaceutical purposes. Its molecular structure allows for potential interactions with biological targets, making it of interest in drug development. Additionally, the compound's physical properties, such as boiling point, melting point, and solubility, are influenced by its functional groups and overall molecular architecture. As with many organic compounds, safety and handling precautions should be observed, particularly in laboratory settings, due to potential toxicity or reactivity.

Formula: C₁₃H₁₃NO₂

InChI: InChI=1/C13H13NO2/c1-3-16-13(15)11-6-7-12-10(8-11)5-4-9(2)14-12/h4-8H,3H2,1-2H3

SMILES: CCOC(=O)c1ccc2c(ccc(C)n2)c1

Synonyms:

• 6-Quinolinecarboxylic Acid, 2-Methyl-, Ethyl Ester

Ethyl 2-methylquinoline-6-carboxylate, 97%

CAS: 855763-77-8

This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci

Formula: C₁₃H₁₃NO₂

Purity: 97%

Molecular weight: 215.25

Ref: 02-H63213

ETHYL 2-METHYLQUINOLINE-6-CARBOXYLATE

CAS: 855763-77-8

Formula: C₁₃H₁₃NO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 215.2478

Ref: IN-DA004UF2

Ethyl 2-methylquinoline-6-carboxylate

CAS: 855763-77-8

Ethyl 2-methylquinoline-6-carboxylate

Purity: 97%

Molecular weight: 215.25g/mol

Ref: 54-OR1068801

Ethyl 2-methylquinoline-6-carboxylate

CAS: 855763-77-8

Formula: C₁₃H₁₃NO₂

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 215.252

Ref: 10-F227811