CAS 85582-62-3

2-[(3-fluorophenyl)methylsulfanyl]ethanol

Description:

2-[(3-Fluorophenyl)methylsulfanyl]ethanol, with the CAS number 85582-62-3, is an organic compound characterized by the presence of a fluorophenyl group and a thiol ether functional group. This compound features a sulfur atom bonded to a methyl group and an ethanol moiety, which contributes to its solubility in polar solvents. The presence of the fluorine atom in the phenyl ring can influence the compound's reactivity and polarity, potentially enhancing its biological activity. The molecular structure suggests that it may exhibit properties typical of both alcohols and thiols, such as hydrogen bonding capabilities and nucleophilicity. Additionally, the compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the fluorinated aromatic ring, which is often associated with improved metabolic stability and bioavailability. Overall, 2-[(3-fluorophenyl)methylsulfanyl]ethanol is a compound of interest for further research in various chemical and biological contexts.

Formula: C₉H₁₁FOS

InChI: InChI=1/C9H11FOS/c10-9-3-1-2-8(6-9)7-12-5-4-11/h1-3,6,11H,4-5,7H2

SMILES: c1cc(cc(c1)F)CSCCO

2-[(3-fluorobenzyl)thio]ethanol

CAS: 85582-62-3

Formula: C₉H₁₁FOS

Purity: 95.0%

Molecular weight: 186.24

Ref: 10-F316168