CAS 85583-41-1

4-[2-(3-Methyl-2-pyridinyl)ethoxy]benzenamine

Description:

4-[2-(3-Methyl-2-pyridinyl)ethoxy]benzenamine, with the CAS number 85583-41-1, is an organic compound characterized by its aromatic amine structure. It features a benzene ring substituted with an ethoxy group and a pyridine moiety, specifically a 3-methyl-2-pyridinyl group. This compound is likely to exhibit properties typical of aromatic amines, such as being a solid at room temperature and having moderate solubility in organic solvents. The presence of the pyridine ring may impart basicity and influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the compound may exhibit biological activity, which could be of interest in pharmaceutical applications. Its molecular structure suggests potential interactions with biological systems, possibly influencing its pharmacokinetic and pharmacodynamic properties. Safety data should be consulted for handling and usage, as aromatic amines can pose health risks. Overall, this compound's unique structure may lead to diverse applications in organic synthesis and medicinal chemistry.

Formula: C₁₄H₁₆N₂O

InChI: InChI=1S/C14H16N2O/c1-11-3-2-9-16-14(11)8-10-17-13-6-4-12(15)5-7-13/h2-7,9H,8,10,15H2,1H3

InChI key: InChIKey=XVOPKNHFHUOKCP-UHFFFAOYSA-N

SMILES: C(COC1=CC=C(N)C=C1)C2=C(C)C=CC=N2

Synonyms:

• 4-[2-(3-Methyl-2-pyridinyl)ethoxy]benzenamine
• Benzenamine, 4-[2-(3-methyl-2-pyridinyl)ethoxy]-