CymitQuimica logo

CAS 85586-65-8

:

3,6,9,12,14,17,20,23-Octaoxa-13-borapentacosane-1,25-diol, 13-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]-

Description:
3,6,9,12,14,17,20,23-Octaoxa-13-borapentacosane-1,25-diol, with the CAS number 85586-65-8, is a complex organic compound characterized by its unique boron-containing structure and multiple ether linkages. This compound features a long carbon chain with eight ether groups, which contribute to its solubility in polar solvents and potential applications in various fields, including materials science and pharmaceuticals. The presence of boron in its structure may impart specific properties such as enhanced stability or reactivity, making it of interest in boron chemistry. The hydroxyl groups in the molecule suggest potential for hydrogen bonding, which can influence its physical properties, such as melting and boiling points, as well as its interaction with biological systems. Overall, this compound exemplifies the intricate design of synthetic organic molecules, showcasing the interplay between boron chemistry and polyether functionalities. Its specific applications and behavior would depend on further empirical studies and characterization.
Formula:C24H51BO15
InChI:InChI=1S/C24H51BO15/c26-1-4-29-7-10-32-13-16-35-19-22-38-25(39-23-20-36-17-14-33-11-8-30-5-2-27)40-24-21-37-18-15-34-12-9-31-6-3-28/h26-28H,1-24H2
InChI key:InChIKey=IVGSDRZOVZCWLB-UHFFFAOYSA-N
SMILES:B(OCCOCCOCCOCCO)(OCCOCCOCCOCCO)OCCOCCOCCOCCO
Synonyms:
  • 3,6,9,12,14,17,20,23-Octaoxa-13-borapentacosane-1,25-diol, 13-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.