CAS 85589-69-1

1-chloronaphtho[2,1-b]thiophene-2-carboxylic acid

Description:

1-Chloronaphtho[2,1-b]thiophene-2-carboxylic acid is an organic compound characterized by its complex structure, which includes a naphthalene ring fused with a thiophene moiety and a carboxylic acid functional group. The presence of the chlorine atom introduces halogen characteristics, influencing the compound's reactivity and polarity. This compound typically exhibits properties such as moderate solubility in organic solvents and limited solubility in water due to its hydrophobic naphthalene and thiophene components. The carboxylic acid group contributes to its acidity and potential for hydrogen bonding, which can affect its interactions in various chemical environments. Additionally, the compound may display interesting electronic properties due to the conjugated system formed by the aromatic rings, making it potentially useful in organic electronics or as a precursor in synthetic organic chemistry. Its specific applications and behavior can vary based on the context of use, including potential roles in pharmaceuticals, materials science, or as an intermediate in chemical synthesis.

Formula: C₁₃H₇ClO₂S

InChI: InChI=1/C13H7ClO2S/c14-11-10-8-4-2-1-3-7(8)5-6-9(10)17-12(11)13(15)16/h1-6H,(H,15,16)

SMILES: c1ccc2c(c1)ccc1c2c(c(C(=O)O)s1)Cl

Synonyms:

• Naphtho[2,1-B]Thiophene-2-Carboxylic Acid, 1-Chloro-