CAS 85591-93-1

(4-bromo-1-hydroxy-2,2,5,5-tetramethyl-pyrrol-3-yl)methanol

Description:

(4-bromo-1-hydroxy-2,2,5,5-tetramethyl-pyrrol-3-yl)methanol, with the CAS number 85591-93-1, is a chemical compound characterized by its unique structure that includes a bromine atom and a hydroxyl group attached to a pyrrole ring. This compound features a tetramethyl substitution pattern, which contributes to its steric hindrance and potentially influences its reactivity and solubility. The presence of the hydroxyl group suggests that it may exhibit alcohol-like properties, including the ability to form hydrogen bonds, which can affect its solubility in polar solvents. The bromine substituent may also impart specific reactivity, making it a candidate for various chemical transformations. Additionally, the compound's pyrrole ring indicates potential applications in organic synthesis and materials science, particularly in the development of dyes, pharmaceuticals, or agrochemicals. Overall, the combination of these functional groups and structural features makes this compound of interest in both academic and industrial research contexts.

Formula: C₉H₁₆BrNO₂

InChI: InChI=1/C9H16BrNO2/c1-8(2)6(5-12)7(10)9(3,4)11(8)13/h12-13H,5H2,1-4H3

SMILES: CC1(C)C(=C(C(C)(C)N1O)Br)CO

4-Bromo-3-hydroxymethyl-1-oxyl-2,2,5,5-tetramethyl-delta3-pyrroline

Controlled Product

CAS: 85591-93-1

Applications A spin label.
References Berliner, L.J., et al.: Analytical Biochemistry, 119, 450 (1982)

Formula: C₉H₁₅BrNO₂

Color and Shape: Neat

Molecular weight: 252.14

Ref: TR-B684470