CAS 85591-99-7

3-Bromo-4-formyl-2,5-dihydro-2,2,5,5-tetramethyl-1H-pyrrol-1-yloxy

Description:

3-Bromo-4-formyl-2,5-dihydro-2,2,5,5-tetramethyl-1H-pyrrol-1-yloxy is a chemical compound characterized by its unique structure, which includes a pyrrole ring substituted with a bromine atom and a formyl group. This compound features a dihydropyrrole moiety, indicating partial saturation of the pyrrole ring, which contributes to its reactivity and stability. The presence of the formyl group suggests potential for further chemical transformations, such as condensation reactions. The tetramethyl substituents enhance the steric bulk around the nitrogen atom, influencing the compound's electronic properties and solubility. Additionally, the presence of the nitroxide functional group (indicated by the "yloxy" suffix) suggests that this compound may exhibit paramagnetic properties, making it of interest in various applications, including organic synthesis and materials science. Overall, the combination of these functional groups imparts distinctive chemical behavior, making it a subject of interest in both academic and industrial research.

Formula: C₉H₁₃BrNO₂

InChI: InChI=1S/C9H13BrNO2/c1-8(2)6(5-12)7(10)9(3,4)11(8)13/h5H,1-4H3

InChI key: InChIKey=RSSNJAMZRRCASK-UHFFFAOYSA-N

SMILES: CC1(C)C(C=O)=C(Br)C(C)(C)N1[O]

Synonyms:

• 3-Bromo-4-formyl-2,5-dihydro-2,2,5,5-tetramethyl-1H-pyrrol-1-yloxy
• 1H-Pyrrol-1-yloxy, 3-bromo-4-formyl-2,5-dihydro-2,2,5,5-tetramethyl-

3-Bromo-4-formyl-2,5-dihydro-2,2,5,5-tetramethyl-1H-pyrrol-1-yloxy

Controlled Product

CAS: 85591-99-7

Applications 3-Bromo-4-formyl-2,5-dihydro-2,2,5,5-tetramethyl-1H-pyrrol-1-yloxy is an intermediate in the synthesis of highly active spin labelling reagents.
References Kalaim, T., et al: Synthesis., 10, 1702 (2010); Fawzi, N.L., et al.: J. Biomolec. NMR., 51, 105 (2011);

Formula: C₈H₁₄O₇

Color and Shape: Neat

Molecular weight: 222.193

Ref: TR-B687430