CAS 85592-79-6

3-Amino-N-(1-phenylethyl)benzamide

Description:

3-Amino-N-(1-phenylethyl)benzamide, identified by its CAS number 85592-79-6, is an organic compound characterized by the presence of an amine group and a benzamide structure. This compound features a phenylethyl group attached to the nitrogen of the amide, which contributes to its unique properties. It typically appears as a solid at room temperature and is soluble in organic solvents, reflecting its hydrophobic characteristics due to the aromatic rings. The amino group can participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs targeting specific receptors or enzymes. Its synthesis often involves standard organic reactions, such as amide formation, and it can be characterized using techniques like NMR spectroscopy and mass spectrometry. Overall, 3-Amino-N-(1-phenylethyl)benzamide is a versatile compound with potential applications in medicinal chemistry and related fields.

Formula: C₁₅H₁₆N₂O

InChI: InChI=1S/C15H16N2O/c1-11(12-6-3-2-4-7-12)17-15(18)13-8-5-9-14(16)10-13/h2-11H,16H2,1H3,(H,17,18)

InChI key: InChIKey=ZNBFXLWERBRCIT-UHFFFAOYSA-N

SMILES: C(NC(C)C1=CC=CC=C1)(=O)C2=CC(N)=CC=C2

Synonyms:

• 3-Amino-N-(1-phenylethyl)benzamide
• Benzamide, 3-amino-N-(1-phenylethyl)-
• Benzamide, 3-amino-N-(1-phenylethyl)-, (±)-