CymitQuimica logo

CAS 85598-51-2

:

3-Nitro-2-thiophenecarbonitrile

Description:
3-Nitro-2-thiophenecarbonitrile is an organic compound characterized by the presence of a thiophene ring, a nitro group, and a cyano group. The thiophene ring contributes to its aromatic properties, while the nitro group (-NO2) is known for its electron-withdrawing effects, which can influence the compound's reactivity and stability. The cyano group (-CN) adds to the compound's polarity and can participate in various chemical reactions, such as nucleophilic additions. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its unique structure makes it of interest in various fields, including pharmaceuticals and materials science, where it may serve as an intermediate in the synthesis of more complex molecules. Additionally, due to the presence of both the nitro and cyano groups, it may exhibit interesting electronic properties, making it a candidate for studies in organic electronics or as a building block in the development of agrochemicals. Safety precautions should be taken when handling this compound, as nitro compounds can be hazardous.
Formula:C5H2N2O2S
InChI:InChI=1S/C5H2N2O2S/c6-3-5-4(7(8)9)1-2-10-5/h1-2H
InChI key:InChIKey=KKDUMKHQWFEBPK-UHFFFAOYSA-N
SMILES:C(#N)C1=C(N(=O)=O)C=CS1
Synonyms:
  • 3-Nitro-2-thiophenecarbonitrile
  • 2-Cyano-3-nitrothiophene
  • 3-Nitrothiophene-2-carbonitrile
  • 2-Thiophenecarbonitrile, 3-nitro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.