CAS 85599-32-2

3-([1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propan-1-ol

Description:

3-([1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propan-1-ol is a chemical compound characterized by its unique structure, which includes a triazole ring fused to a pyrimidine moiety. This compound features a propanol side chain, contributing to its potential as a bioactive molecule. The presence of the triazole and pyrimidine rings suggests that it may exhibit interesting pharmacological properties, possibly acting as an inhibitor or modulator in various biological pathways. The hydroxyl group in the propanol chain can enhance solubility and reactivity, making it a candidate for further chemical modifications. Additionally, the compound's molecular structure may allow for interactions with specific biological targets, which is of interest in medicinal chemistry. Its CAS number, 85599-32-2, facilitates its identification in chemical databases, aiding researchers in locating relevant studies and applications. Overall, this compound represents a class of heterocyclic compounds that are often explored for their potential therapeutic uses.

Formula: C₈H₁₀N₄O

InChI: InChI=1/C8H10N4O/c13-3-1-2-7-4-9-8-10-6-11-12(8)5-7/h4-6,13H,1-3H2

SMILES: C(Cc1cnc2ncnn2c1)CO

Synonyms:

• [1,2,4]Triazolo[1,5-A]Pyrimidine-6-Propanol

3-[1,2,4]triazolo[1,5-a]pyrimidin-6-ylpropan-1-ol

CAS: 85599-32-2

Formula: C₈H₁₀N₄O

Purity: 95.0%

Molecular weight: 178.195

Ref: 10-F308769