CAS 85599-33-3

6-Methyl[1,2,4]triazolo[1,5-a]pyrimidin-2-amine

Description:

6-Methyl[1,2,4]triazolo[1,5-a]pyrimidin-2-amine is a heterocyclic compound characterized by its triazole and pyrimidine ring systems. This compound features a methyl group at the 6-position of the triazole ring and an amino group at the 2-position of the pyrimidine moiety, contributing to its potential biological activity. It is typically a crystalline solid, and its structure allows for various interactions, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of both nitrogen-containing rings enhances its solubility and reactivity, which can be advantageous in drug design. Additionally, the compound may exhibit properties such as antimicrobial or antitumor activity, although specific biological effects would depend on further empirical studies. Its CAS number, 85599-33-3, is a unique identifier that facilitates its recognition in chemical databases and literature. As with many heterocycles, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature.

Formula: C₆H₇N₅

InChI: InChI=1S/C6H7N5/c1-4-2-8-6-9-5(7)10-11(6)3-4/h2-3H,1H3,(H2,7,10)

InChI key: InChIKey=HMZRQVTYTROQJG-UHFFFAOYSA-N

SMILES: NC=1N=C2N(N1)C=C(C)C=N2

Synonyms:

• 6-Methyl[1,2,4]triazolo[1,5-a]pyrimidin-2-amine
• [1,2,4]Triazolo[1,5-a]pyrimidin-2-amine, 6-methyl-