CAS 855991-49-0

β-Ethyl-β-methyl-2-benzothiazolebutanoic acid

Description:

β-Ethyl-β-methyl-2-benzothiazolebutanoic acid, identified by its CAS number 855991-49-0, is a chemical compound that belongs to the class of benzothiazole derivatives. This substance typically exhibits characteristics such as being a solid at room temperature, with potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of both ethyl and methyl groups in its structure suggests that it may possess unique steric and electronic properties, which can influence its reactivity and interaction with biological systems. Additionally, the benzothiazole moiety is known for its biological activity, often contributing to the compound's potential as a bioactive agent. The carboxylic acid functional group in its structure may impart acidic properties, affecting solubility and reactivity in different environments. Overall, β-Ethyl-β-methyl-2-benzothiazolebutanoic acid is a compound of interest for further research, particularly in the context of its chemical behavior and potential applications.

Formula: C₁₄H₁₇NO₂S

InChI: InChI=1S/C14H17NO2S/c1-3-14(2,9-13(16)17)8-12-15-10-6-4-5-7-11(10)18-12/h4-7H,3,8-9H2,1-2H3,(H,16,17)

InChI key: InChIKey=GIBIKRFPDXOAHN-UHFFFAOYSA-N

SMILES: C(C(CC(O)=O)(CC)C)C1=NC=2C(S1)=CC=CC2

Synonyms:

• 2-Benzothiazolebutanoic acid, β-ethyl-β-methyl-
• β-Ethyl-β-methyl-2-benzothiazolebutanoic acid