
CAS 855991-59-2
:2-(Bromomethyl)-5-(4-fluorophenyl)oxazole
Description:
2-(Bromomethyl)-5-(4-fluorophenyl)oxazole is a chemical compound characterized by its oxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen. The presence of a bromomethyl group indicates a bromine atom attached to a carbon that is also bonded to a methyl group, enhancing its reactivity and potential for further chemical modifications. The 4-fluorophenyl substituent contributes to the compound's overall polarity and can influence its electronic properties, making it of interest in various chemical applications, including medicinal chemistry and material science. This compound may exhibit specific biological activities due to its structural features, which can be explored in drug development. Additionally, its unique combination of functional groups may allow for diverse synthetic pathways, making it a valuable intermediate in organic synthesis. As with many halogenated compounds, safety precautions should be taken during handling due to potential toxicity and environmental impact.
Formula:C10H7BrFNO
InChI:InChI=1S/C10H7BrFNO/c11-5-10-13-6-9(14-10)7-1-3-8(12)4-2-7/h1-4,6H,5H2
InChI key:InChIKey=WGLQYADVKZNXHC-UHFFFAOYSA-N
SMILES:C(Br)C=1OC(=CN1)C2=CC=C(F)C=C2
Synonyms:- Oxazole, 2-(bromomethyl)-5-(4-fluorophenyl)-
- 2-(Bromomethyl)-5-(4-fluorophenyl)oxazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.