CAS 855991-67-2

5-[(Diethylamino)sulfonyl]-2-[(2-methoxyethyl)amino]benzoic acid

Description:

5-[(Diethylamino)sulfonyl]-2-[(2-methoxyethyl)amino]benzoic acid, with CAS number 855991-67-2, is a synthetic organic compound characterized by its complex structure, which includes a benzoic acid moiety substituted with a sulfonyl group and two amino functionalities. This compound typically exhibits properties such as solubility in polar solvents due to the presence of amino and sulfonyl groups, which can engage in hydrogen bonding. The diethylamino group contributes to its basicity, while the methoxyethyl group enhances its lipophilicity. The presence of the carboxylic acid functional group suggests that it can participate in acid-base reactions, making it potentially useful in various chemical applications, including pharmaceuticals. Additionally, the compound may exhibit biological activity, which could be explored in medicinal chemistry contexts. Its stability and reactivity would depend on the specific conditions, such as pH and temperature, under which it is handled. Overall, this compound represents a class of molecules that may have significant utility in drug development and other chemical applications.

Formula: C₁₄H₂₂N₂O₅S

InChI: InChI=1S/C14H22N2O5S/c1-4-16(5-2)22(19,20)11-6-7-13(15-8-9-21-3)12(10-11)14(17)18/h6-7,10,15H,4-5,8-9H2,1-3H3,(H,17,18)

InChI key: InChIKey=AANISZQFOXUQFH-UHFFFAOYSA-N

SMILES: S(N(CC)CC)(=O)(=O)C1=CC(C(O)=O)=C(NCCOC)C=C1

Synonyms:

• 5-[(Diethylamino)sulfonyl]-2-[(2-methoxyethyl)amino]benzoic acid
• Benzoic acid, 5-[(diethylamino)sulfonyl]-2-[(2-methoxyethyl)amino]-