CymitQuimica logo

CAS 855991-74-1

:

2-[(Diethylamino)methyl]-5,6-dimethylthieno[2,3-d]pyrimidine-4(3H)-thione

Description:
2-[(Diethylamino)methyl]-5,6-dimethylthieno[2,3-d]pyrimidine-4(3H)-thione, with the CAS number 855991-74-1, is a synthetic organic compound characterized by its thieno[2,3-d]pyrimidine core structure, which incorporates a thione functional group. This compound features a diethylamino group, contributing to its potential as a pharmacological agent, particularly in medicinal chemistry. The presence of methyl groups at the 5 and 6 positions of the pyrimidine ring enhances its lipophilicity, which may influence its biological activity and solubility properties. The thione group can participate in various chemical reactions, including nucleophilic attacks, making it a versatile building block in organic synthesis. Additionally, the compound's structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Its unique combination of functional groups and structural features positions it as a candidate for further research in drug development and other chemical applications.
Formula:C13H19N3S2
InChI:InChI=1S/C13H19N3S2/c1-5-16(6-2)7-10-14-12(17)11-8(3)9(4)18-13(11)15-10/h5-7H2,1-4H3,(H,14,15,17)
InChI key:InChIKey=JZTSLURIHPAIGZ-UHFFFAOYSA-N
SMILES:S=C1C2=C(NC(CN(CC)CC)=N1)SC(C)=C2C
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.