CAS 85603-43-6
:(1R,2S)-2-(3,4-dimethylbenzoyl)cyclohexane-1-carboxylic acid
Description:
The chemical substance known as (1R,2S)-2-(3,4-dimethylbenzoyl)cyclohexane-1-carboxylic acid, with the CAS number 85603-43-6, is a chiral compound characterized by its cyclohexane ring structure, which is substituted with a carboxylic acid group and a benzoyl moiety. The presence of the 3,4-dimethyl substitution on the benzoyl group contributes to its unique steric and electronic properties, influencing its reactivity and interactions. This compound is likely to exhibit both acidic behavior due to the carboxylic acid functional group and potential hydrophobic characteristics due to the aromatic and aliphatic components. Its chirality suggests that it may have specific biological activity or interactions, making it of interest in pharmaceutical applications. The compound's solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. Overall, this substance is significant in the context of organic synthesis and medicinal chemistry, where its structural features may be leveraged for various applications.
Formula:C16H20O3
InChI:InChI=1/C16H20O3/c1-10-7-8-12(9-11(10)2)15(17)13-5-3-4-6-14(13)16(18)19/h7-9,13-14H,3-6H2,1-2H3,(H,18,19)/t13-,14+/m0/s1
Synonyms:- (1R,2S)-2-(3,4-Dimethylbenzoyl)cyclohexanecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.