CAS 85603-44-7

(1R,2S)-2-(2,4-dimethylbenzoyl)cyclohexane-1-carboxylic acid

Description:

The chemical substance known as (1R,2S)-2-(2,4-dimethylbenzoyl)cyclohexane-1-carboxylic acid, with the CAS number 85603-44-7, is an organic compound characterized by its cyclohexane structure substituted with a carboxylic acid group and a dimethylbenzoyl moiety. This compound features a chiral center, which contributes to its stereochemistry, specifically the (1R,2S) configuration. The presence of the carboxylic acid functional group indicates that it can participate in acid-base reactions, potentially forming salts or esters. The dimethylbenzoyl group adds to its hydrophobic character, influencing its solubility and interaction with biological systems. This compound may exhibit interesting properties such as potential biological activity, making it of interest in pharmaceutical research. Its structural features suggest it could be involved in various chemical reactions, including esterification and acylation. Overall, the unique combination of functional groups and stereochemistry contributes to its potential applications in organic synthesis and medicinal chemistry.

Formula: C₁₆H₂₀O₃

InChI: InChI=1/C16H20O3/c1-10-7-8-12(11(2)9-10)15(17)13-5-3-4-6-14(13)16(18)19/h7-9,13-14H,3-6H2,1-2H3,(H,18,19)/t13-,14+/m0/s1