CAS 856046-33-8

6-bromo-2-phenylquinolin-4-amine

Description:

6-Bromo-2-phenylquinolin-4-amine is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of a bromine atom at the 6-position and a phenyl group at the 2-position contributes to its unique chemical properties. This compound typically exhibits a solid state at room temperature and is often used in medicinal chemistry due to its potential biological activity. The amine functional group at the 4-position can participate in various chemical reactions, making it a versatile intermediate in organic synthesis. Additionally, the compound may exhibit fluorescence properties, which can be useful in biological imaging applications. Its solubility can vary depending on the solvent, and it may show different reactivity patterns based on the substituents present. Overall, 6-bromo-2-phenylquinolin-4-amine is of interest in research for its potential applications in drug development and as a building block in the synthesis of more complex molecules.

Formula: C₁₅H₁₁BrN₂

InChI: InChI=1/C15H11BrN2/c16-11-6-7-14-12(8-11)13(17)9-15(18-14)10-4-2-1-3-5-10/h1-9H,(H2,17,18)

Synonyms:

• 4-quinolinamine, 6-bromo-2-phenyl-
• 6-Bromo-2-phenylquinolin-4-amine

4-Amino-6-bromo-2-phenylquinoline

CAS: 856046-33-8

4-Amino-6-bromo-2-phenylquinoline

Purity: ≥95%

Molecular weight: 299.17g/mol

Ref: 54-OR1075354