CAS 85606-96-8

3-(4-fluorophenyl)piperazin-2-one

Description:

3-(4-Fluorophenyl)piperazin-2-one, with the CAS number 85606-96-8, is a chemical compound that belongs to the class of piperazine derivatives. It features a piperazine ring, which is a six-membered saturated heterocycle containing two nitrogen atoms, and is substituted with a 4-fluorophenyl group and a carbonyl group at the second position. This compound is characterized by its potential biological activity, often studied for its pharmacological properties, including effects on the central nervous system. The presence of the fluorine atom can enhance lipophilicity and influence the compound's interaction with biological targets. Additionally, the piperazine structure is known for its versatility in medicinal chemistry, often serving as a scaffold for various therapeutic agents. The compound may exhibit properties such as solubility in organic solvents and moderate stability under standard conditions. Its synthesis typically involves multi-step organic reactions, and it may be analyzed using techniques like NMR spectroscopy and mass spectrometry to confirm its structure and purity.

Formula: C₁₀H₁₁FN₂O

InChI: InChI=1/C10H11FN2O/c11-8-3-1-7(2-4-8)9-10(14)13-6-5-12-9/h1-4,9,12H,5-6H2,(H,13,14)

SMILES: c1cc(ccc1C1C(=NCCN1)O)F

3-(4-Fluorophenyl)piperazin-2-one

CAS: 85606-96-8

3-(4-Fluorophenyl)piperazin-2-one

Molecular weight: 194.20554g/mol

Ref: 54-PC107186