
CAS 85614-50-2
:1-(2-Benzofuranyl)-1-butanone
Description:
1-(2-Benzofuranyl)-1-butanone, also known by its CAS number 85614-50-2, is an organic compound characterized by its unique structure that includes a benzofuran moiety attached to a butanone group. This compound typically exhibits properties common to ketones, such as being a colorless to pale yellow liquid with a distinctive odor. It is soluble in organic solvents and may have limited solubility in water due to its hydrophobic benzofuran component. The presence of the benzofuran ring contributes to its potential biological activity, making it of interest in medicinal chemistry and research. Additionally, the compound may undergo typical chemical reactions associated with ketones, such as nucleophilic addition and oxidation. Safety data sheets should be consulted for handling and toxicity information, as with any chemical substance. Overall, 1-(2-Benzofuranyl)-1-butanone represents a compound with intriguing structural features and potential applications in various fields, including pharmaceuticals and organic synthesis.
Formula:C12H12O2
InChI:InChI=1S/C12H12O2/c1-2-5-10(13)12-8-9-6-3-4-7-11(9)14-12/h3-4,6-8H,2,5H2,1H3
InChI key:InChIKey=WHWXGPFAKAGINR-UHFFFAOYSA-N
SMILES:C(CCC)(=O)C1=CC=2C(O1)=CC=CC2
Synonyms:- 1-(2-Benzofuranyl)-1-butanone
- 1-Butanone, 1-(2-benzofuranyl)-
- 2-Benzofuranyl propyl ketone
- 1-(1-Benzofuran-2-yl)butan-1-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.