CAS 856209-29-5

1-[amino(4-chlorophenyl)methyl]naphthalen-2-ol hydrochloride

Description:

1-[Amino(4-chlorophenyl)methyl]naphthalen-2-ol hydrochloride is a chemical compound characterized by its complex structure, which includes a naphthalene core substituted with an amino group and a hydroxyl group. The presence of the 4-chlorophenyl group enhances its potential for biological activity, making it of interest in medicinal chemistry. This compound typically appears as a hydrochloride salt, which improves its solubility in water and facilitates its use in various applications, including pharmaceuticals. The molecular structure suggests that it may exhibit properties such as antibacterial or antifungal activity, although specific biological activities would depend on further empirical studies. Additionally, the compound's stability, reactivity, and interaction with biological systems can be influenced by the functional groups present. Safety and handling precautions are essential, as with many chemical substances, particularly those with potential pharmacological effects. Overall, 1-[amino(4-chlorophenyl)methyl]naphthalen-2-ol hydrochloride represents a compound of interest for further research and development in the field of chemistry and drug discovery.

Formula: C₁₇H₁₅Cl₂NO

InChI: InChI=1/C17H14ClNO.ClH/c18-13-8-5-12(6-9-13)17(19)16-14-4-2-1-3-11(14)7-10-15(16)20;/h1-10,17,20H,19H2;1H

SMILES: c1ccc2c(c1)ccc(c2C(c1ccc(cc1)Cl)N)O.Cl

1-[Amino-(4-chloro-phenyl)-methyl]-naphthalen-2-ol hydrochloride

CAS: 856209-29-5

1-[Amino-(4-chloro-phenyl)-methyl]-naphthalen-2-ol hydrochloride

Purity: ≥95%

Molecular weight: 320.21g/mol

Ref: 54-OR307613