CAS 85621-43-8

3,4-Bis(acetyloxy)benzeneacetic acid

Description:

3,4-Bis(acetyloxy)benzeneacetic acid, with the CAS number 85621-43-8, is an organic compound characterized by its structure, which includes a benzene ring substituted with two acetyloxy groups and an acetic acid moiety. This compound typically exhibits properties associated with both aromatic and carboxylic acid functionalities, such as potential solubility in organic solvents and moderate polarity. The presence of the acetyloxy groups suggests that it may participate in esterification reactions and could be hydrolyzed under certain conditions. Its molecular structure may impart specific biological activities, making it of interest in pharmaceutical and biochemical research. Additionally, the compound's stability, reactivity, and potential applications can be influenced by factors such as pH, temperature, and the presence of catalysts. Overall, 3,4-Bis(acetyloxy)benzeneacetic acid represents a versatile chemical entity with potential utility in various chemical and medicinal contexts.

Formula: C₁₂H₁₂O₆

InChI: InChI=1S/C12H12O6/c1-7(13)17-10-4-3-9(6-12(15)16)5-11(10)18-8(2)14/h3-5H,6H2,1-2H3,(H,15,16)

InChI key: InChIKey=VYELVKLTNGETIC-UHFFFAOYSA-N

SMILES: O(C(C)=O)C1=C(OC(C)=O)C=CC(CC(O)=O)=C1

Synonyms:

• 3,4-Bis(acetyloxy)benzeneacetic acid
• Benzeneacetic acid, 3,4-bis(acetyloxy)-
• [3,4-Bis(Acetyloxy)Phenyl]Acetic Acid
• 3,4-Diacetoxyphenylacetic acid

3,4-Diacetoxyphenylacetic acid

CAS: 85621-43-8

3,4-Diacetoxyphenylacetic acid is a white crystalline solid. It is soluble in water, ethanol and acetone. This chemical is a useful building block for the synthesis of a wide range of compounds including pharmaceuticals, pesticides and agrochemicals. 3,4-Diacetoxyphenylacetic acid has been used as a reagent for the synthesis of various complex compounds such as anti-inflammatory drugs and antibiotics. 3,4-Diacetoxyphenylacetic acid can be used as a versatile building block in the synthesis of many different compounds with high purity and quality.

Formula: C₁₂H₁₂O₆

Purity: Min. 95%

Molecular weight: 252.22 g/mol

Ref: 3D-FD67075