CAS 85622-95-3

Mitozolomide

Description:

Mitozolomide, with the CAS number 85622-95-3, is a synthetic alkylating agent primarily used in the treatment of certain types of cancer, particularly gliomas. It is a derivative of the well-known chemotherapeutic agent, temozolomide, and functions by interfering with DNA replication and repair, ultimately leading to cell death in rapidly dividing cancer cells. Mitozolomide is characterized by its ability to cross the blood-brain barrier, making it particularly effective for brain tumors. The compound is typically administered orally and is known for its relatively favorable side effect profile compared to other alkylating agents. Its mechanism of action involves the formation of DNA adducts, which disrupts the normal structure and function of DNA, thereby inhibiting tumor growth. Additionally, Mitozolomide is often studied in combination with other therapeutic agents to enhance its efficacy and overcome resistance mechanisms in cancer treatment. As with all chemotherapeutic agents, careful monitoring for potential side effects and interactions is essential during treatment.

Formula: C₇H₇ClN₆O₂

InChI: InChI=1S/C7H7ClN6O2/c8-1-2-14-7(16)13-3-10-4(5(9)15)6(13)11-12-14/h3H,1-2H2,(H2,9,15)

InChI key: InChIKey=QXYYYPFGTSJXNS-UHFFFAOYSA-N

SMILES: C(N)(=O)C1=C2N(C(=O)N(CCCl)N=N2)C=N1

Synonyms:

• Mitozolomide
• CCRG 81010
• M and B 39565
• Imidazo[5,1-d]-1,2,3,5-tetrazine-8-carboxamide, 3-(2-chloroethyl)-3,4-dihydro-4-oxo-
• 3-(2-Chloroethyl)-3,4-dihydro-4-oxoimidazo[5,1-d]-1,2,3,5-tetrazine-8-carboxamide