CAS 856250-49-2
:(1-benzyl-5-chloro-6-oxo-pyridazin-4-yl) trifluoromethanesulfonate
Description:
(1-benzyl-5-chloro-6-oxo-pyridazin-4-yl) trifluoromethanesulfonate, with the CAS number 856250-49-2, is a chemical compound characterized by its unique structure that includes a pyridazine ring substituted with a benzyl group and a chloro group, along with a trifluoromethanesulfonate moiety. This compound typically exhibits properties associated with both its aromatic and heterocyclic components, such as potential reactivity in nucleophilic substitution reactions due to the presence of the trifluoromethanesulfonate group, which is a good leaving group. The chloro substituent may influence the compound's reactivity and stability, while the oxo group contributes to its overall electronic properties. Additionally, the trifluoromethanesulfonate group enhances solubility in polar solvents and may impart unique biological activity, making it of interest in medicinal chemistry. Overall, this compound's characteristics suggest potential applications in pharmaceuticals or agrochemicals, although specific biological or chemical activity would require further investigation.
Formula:C12H8ClF3N2O4S
InChI:InChI=1/C12H8ClF3N2O4S/c13-10-9(22-23(20,21)12(14,15)16)6-17-18(11(10)19)7-8-4-2-1-3-5-8/h1-6H,7H2
SMILES:c1ccc(cc1)Cn1c(=O)c(c(cn1)OS(=O)(=O)C(F)(F)F)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Benzyl-4-chloro-5-[(trifluoromethyl)sulphonyloxy]-2H-pyridazin-3-one
CAS:2-Benzyl-4-chloro-5-[(trifluoromethyl)sulphonyloxy]-2H-pyridazin-3-one
Molecular weight:368.72g/mol
