CAS 856286-98-1
:1-(3-methyl-1-piperidyl)propan-2-one
Description:
1-(3-Methyl-1-piperidyl)propan-2-one, with the CAS number 856286-98-1, is a chemical compound that belongs to the class of piperidine derivatives. It features a piperidine ring substituted with a methyl group and is attached to a propan-2-one moiety, which contributes to its ketone functional group. This compound is typically characterized by its moderate polarity due to the presence of both hydrophobic (the piperidine ring and alkyl chain) and hydrophilic (the carbonyl group) components. It may exhibit basic properties due to the nitrogen atom in the piperidine ring, allowing it to participate in various chemical reactions, including nucleophilic attacks. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as piperidine derivatives are often associated with biological activity. However, specific physical properties such as boiling point, melting point, and solubility would need to be referenced from experimental data or literature for precise applications and handling guidelines.
Formula:C9H17NO
InChI:InChI=1/C9H17NO/c1-8-4-3-5-10(6-8)7-9(2)11/h8H,3-7H2,1-2H3
SMILES:CC1CCCN(C1)CC(=O)C
Synonyms:- 1-(3-Methylpiperidin-1-Yl)Propan-2-One
- 2-Propanone, 1-(3-Methyl-1-Piperidinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
