CAS 856289-68-4

2,4-Pyrimidinediamine, N,N′-dimethyl-

Description:

2,4-Pyrimidinediamine, N,N′-dimethyl- is an organic compound characterized by its pyrimidine ring structure, which features two amino groups at the 2 and 4 positions and two methyl groups attached to the nitrogen atoms. This compound is typically a white to off-white solid and is soluble in polar solvents, reflecting its amine functional groups. It is primarily used in pharmaceutical research and development, particularly in the synthesis of various biologically active molecules. The presence of the dimethylamino groups enhances its basicity and can influence its reactivity and interaction with biological targets. Additionally, the compound may exhibit properties such as antimicrobial or antitumor activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance. Overall, 2,4-Pyrimidinediamine, N,N′-dimethyl- serves as a versatile building block in organic synthesis and drug development.

Formula: C₆H₁₀N₄

InChI: InChI=1S/C6H10N4/c1-7-5-3-4-9-6(8-2)10-5/h3-4H,1-2H3,(H2,7,8,9,10)

InChI key: InChIKey=QGHXLJPQRACLPV-UHFFFAOYSA-N

SMILES: N(C)C1=NC(NC)=NC=C1

Synonyms:

• 2-N,4-N-Dimethylpyrimidine-2,4-diamine
• Pyrimidine, 2,4-bis(methylamino)-
• 2,4-Pyrimidinediamine, N,N′-dimethyl-