CymitQuimica logo

CAS 856311-42-7

:

2,4,6-Boroxintriamine

Description:
2,4,6-Boroxintriamine, identified by its CAS number 856311-42-7, is a chemical compound that features a boron atom coordinated to three amine groups. This compound is characterized by its unique structure, which includes a boron atom at the center, surrounded by nitrogen atoms that can participate in hydrogen bonding and coordination chemistry. The presence of boron in the structure often imparts interesting properties, such as the ability to form stable complexes with various anions or other metal ions. Additionally, 2,4,6-Boroxintriamine may exhibit properties typical of amines, including basicity and nucleophilicity, making it potentially useful in various chemical reactions and applications, such as catalysis or as a building block in organic synthesis. Its stability, solubility, and reactivity can vary depending on the specific conditions and the presence of other functional groups. As with many boron-containing compounds, safety and handling precautions should be observed due to potential reactivity and toxicity.
Formula:B3H6N3O3
InChI:InChI=1S/B3H6N3O3/c4-1-7-2(5)9-3(6)8-1/h4-6H2
InChI key:InChIKey=QXACHBAENREMTI-UHFFFAOYSA-N
SMILES:NB1OB(N)OB(N)O1
Synonyms:
  • Boroxin, triamino-
  • 2,4,6-Boroxintriamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.