CAS 856405-77-1
:9,9-Dimethyl-4,5-bis(di-tert-butylphosphino)xanthene
Description:
9,9-Dimethyl-4,5-bis(di-tert-butylphosphino)xanthene is a specialized organophosphorus compound notable for its unique structural features and applications in coordination chemistry and catalysis. This compound contains a xanthene backbone, which is a polycyclic aromatic structure, substituted with two di-tert-butylphosphino groups that enhance its reactivity and solubility in organic solvents. The presence of the bulky tert-butyl groups provides steric hindrance, which can influence the electronic properties and coordination behavior of the phosphine ligands. This compound is often utilized in the development of transition metal complexes, particularly in catalysis for organic transformations, due to its ability to stabilize metal centers and facilitate various reactions. Additionally, its unique structure may impart specific optical or electronic properties, making it of interest in materials science. As with many organophosphorus compounds, handling should be done with care, considering potential toxicity and environmental impact.
Formula:C31H48OP2
InChI:InChI=1S/C31H48OP2/c1-27(2,3)33(28(4,5)6)23-19-15-17-21-25(23)32-26-22(31(21,13)14)18-16-20-24(26)34(29(7,8)9)30(10,11)12/h15-20H,1-14H3
SMILES:CC(C)(C)P(c1cccc2c1Oc1c(cccc1P(C(C)(C)C)C(C)(C)C)C2(C)C)C(C)(C)C
Synonyms:- Phosphine, 1,1'-(9,9-dimethyl-9H-xanthene-4,5-diyl)bis[1,1-bis(1,1-dimethylethyl)-
- 9,9-Dimethyl-4,5-bis(di-t-butylphosphino)xanthene
- 4,5-Bis[Di(Tert-Butyl)Phosphino]-9,9-Dimethyl-9H-Xanthene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
9,9-Dimethyl-4,5-bis(di-t-butylphosphino)xanthene, min. 97% t-Bu-XANTPHOS
CAS:9,9-Dimethyl-4,5-bis(di-t-butylphosphino)xanthene, min. 97% t-Bu-XANTPHOS
Formula:C31H48OP2Purity:min. 97%Color and Shape:white to light yellow pwdr.Molecular weight:498.66Phosphine, 1,1'-(9,9-dimethyl-9H-xanthene-4,5-diyl)bis[1,1-bis(1,1-dimethylethyl)-
CAS:Formula:C31H48OP2Purity:97%Color and Shape:SolidMolecular weight:498.6597(9,9-Dimethyl-9H-xanthene-4,5-diyl)bis(di-tert-butylphosphine)
CAS:(9,9-Dimethyl-9H-xanthene-4,5-diyl)bis(di-tert-butylphosphine)Purity:98%Molecular weight:498.66g/mol(9,9-Dimethyl-9H-xanthene-4,5-diyl)bis(di-tert-butylphosphine)
CAS:Purity:97%Molecular weight:498.6719971(9,9-Dimethyl-9H-xanthene-4,5-diyl)bis(di-tert-butylphosphine)
CAS:9,9-Dimethyl-9H-xanthene-4,5-diyl)bis(di-tert-butylphosphine) is a phosphine ligand that has an electron donating group in its structure. This compound has been shown to be able to react with chloride and aryl boronic acids to form an orthogonal pair of chlorides. 9,9-Dimethyl-9H-xanthene-4,5-diyl)bis(di-tert-butylphosphine) also has the ability to act as a nucleophile and can undergo photophysical reactions. The redox potentials of this compound are dependent upon the solvent and the substrate that is used. When 9,9-Dimethyl-9H-xanthene 4,5 diyl)bis(di tert butylphosphine) reacts with diarylmethanes it forms reactive intermediates that can coordinate with metals suchFormula:C31H48OP2Purity:Min. 95%Molecular weight:498.67 g/mol




