CymitQuimica logo

CAS 856414-35-2

:

ethyl 2-ethoxy-1-{[2'-(1-trityl-1H-tetrazol-5-yl)biphenyl-4-yl]methyl}-1H-benzimidazole-7-carboxylate

Description:
Ethyl 2-ethoxy-1-{[2'-(1-trityl-1H-tetrazol-5-yl)biphenyl-4-yl]methyl}-1H-benzimidazole-7-carboxylate, with the CAS number 856414-35-2, is a complex organic compound characterized by its multi-functional structure. It features a benzimidazole core, which is known for its biological activity, particularly in medicinal chemistry. The presence of an ethoxy group enhances its solubility and potential reactivity, while the trityl-1H-tetrazole moiety may contribute to its pharmacological properties, possibly influencing interactions with biological targets. The biphenyl structure adds to the compound's hydrophobic characteristics, which can affect its bioavailability and distribution in biological systems. This compound is likely to exhibit specific chemical reactivity due to the presence of various functional groups, making it a candidate for further research in drug development or as a chemical probe in biological studies. Its synthesis and characterization would involve standard organic chemistry techniques, and its stability and reactivity would be influenced by the electronic and steric effects of its substituents.
Formula:C45H38N6O3
InChI:InChI=1/C45H38N6O3/c1-3-53-43(52)39-25-16-26-40-41(39)50(44(46-40)54-4-2)31-32-27-29-33(30-28-32)37-23-14-15-24-38(37)42-47-48-49-51(42)45(34-17-8-5-9-18-34,35-19-10-6-11-20-35)36-21-12-7-13-22-36/h5-30H,3-4,31H2,1-2H3
SMILES:CCOC(=O)c1cccc2c1n(Cc1ccc(cc1)c1ccccc1c1nnnn1C(c1ccccc1)(c1ccccc1)c1ccccc1)c(n2)OCC
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.