CAS 856437-58-6

N-(1-methylpiperidin-4-yl)glycine

Description:

N-(1-methylpiperidin-4-yl)glycine is an organic compound characterized by its structure, which includes a glycine moiety linked to a 1-methylpiperidine group. This compound typically exhibits properties associated with both amino acids and piperidine derivatives, such as solubility in polar solvents due to the presence of the amino and carboxylic acid functional groups. It may display basicity due to the piperidine nitrogen, which can participate in hydrogen bonding. The presence of the piperidine ring contributes to its potential biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological conditions. Additionally, its molecular structure suggests it could interact with various receptors or enzymes, influencing its pharmacological profile. As with many compounds, its stability, reactivity, and specific applications would depend on the conditions under which it is used, including pH, temperature, and the presence of other chemical species.

Formula: C₈H₁₆N₂O₂

InChI: InChI=1/C8H16N2O2/c1-10-4-2-7(3-5-10)9-6-8(11)12/h7,9H,2-6H2,1H3,(H,11,12)

SMILES: CN1CCC(CC1)NCC(=O)O

Synonyms:

• glycine, N-(1-methyl-4-piperidinyl)-