CAS 856437-60-0
:6-Amino-1H-benzimidazole-2-butanoic acid
Description:
6-Amino-1H-benzimidazole-2-butanoic acid is a chemical compound characterized by its unique structure, which includes a benzimidazole ring fused with an amino group and a butanoic acid side chain. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of the amino group suggests that it may participate in hydrogen bonding and can act as a base, while the carboxylic acid group can donate protons, making it a zwitterionic species under certain conditions. Its molecular structure allows for various interactions, which may be relevant in pharmaceutical applications, particularly in drug design and development. The compound's solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. Additionally, its CAS number, 856437-60-0, serves as a unique identifier for regulatory and research purposes, facilitating the study of its properties and potential applications in medicinal chemistry and related fields.
Formula:C11H13N3O2
InChI:InChI=1S/C11H13N3O2/c12-7-4-5-8-9(6-7)14-10(13-8)2-1-3-11(15)16/h4-6H,1-3,12H2,(H,13,14)(H,15,16)
InChI key:InChIKey=IULRYUWYLNEPQD-UHFFFAOYSA-N
SMILES:C(CCC(O)=O)C=1NC=2C(N1)=CC=C(N)C2
Synonyms:- 6-Amino-1H-benzimidazole-2-butanoic acid
- 1H-Benzimidazole-2-butanoic acid, 6-amino-
- 1H-Benzimidazole-2-butanoic acid, 5-amino-
- 4-(5-amino-1H-benzo[d]imidazol-2-yl)butanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.