CAS 856437-72-4

α-[(4-Aminophenoxy)methyl]-1H-benzimidazole-1-ethanol

Description:

α-[(4-Aminophenoxy)methyl]-1H-benzimidazole-1-ethanol, with the CAS number 856437-72-4, is a chemical compound that features a benzimidazole core, which is a bicyclic structure containing both benzene and imidazole rings. This compound is characterized by the presence of an amino group and a phenoxy group, which contribute to its potential biological activity. The hydroxyl group in the ethanol moiety enhances its solubility in polar solvents and may influence its interaction with biological targets. The structural features suggest that it may exhibit properties relevant to medicinal chemistry, potentially acting as a pharmacophore in drug development. The compound's specific reactivity, stability, and biological activity would depend on its molecular interactions, which can be influenced by factors such as pH, temperature, and the presence of other chemical species. Overall, this compound represents a class of organic molecules that may have applications in pharmaceuticals or biochemistry, warranting further investigation into its properties and potential uses.

Formula: C₁₆H₁₇N₃O₂

InChI: InChI=1S/C16H17N3O2/c17-12-5-7-14(8-6-12)21-10-13(20)9-19-11-18-15-3-1-2-4-16(15)19/h1-8,11,13,20H,9-10,17H2

InChI key: InChIKey=HZLCHYVYYLYEKP-UHFFFAOYSA-N

SMILES: C(C(COC1=CC=C(N)C=C1)O)N2C=3C(N=C2)=CC=CC3

Synonyms:

• α-[(4-Aminophenoxy)methyl]-1H-benzimidazole-1-ethanol
• 1H-Benzimidazole-1-ethanol, α-[(4-aminophenoxy)methyl]-