
CAS 856437-79-1
:4-Piperidinecarboxylic acid, 1-[(3,4-dimethoxyphenyl)methyl]-
Description:
4-Piperidinecarboxylic acid, 1-[(3,4-dimethoxyphenyl)methyl]- is a chemical compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. This compound features a carboxylic acid functional group, contributing to its acidity and potential reactivity. The presence of the 3,4-dimethoxyphenyl group indicates that it has two methoxy (-OCH3) substituents on a phenyl ring, which can influence its electronic properties and solubility. The overall structure suggests that it may exhibit biological activity, potentially serving as a pharmacophore in medicinal chemistry. The compound's molecular interactions could be affected by the steric and electronic effects of the methoxy groups, which may enhance its lipophilicity and ability to cross biological membranes. Additionally, the piperidine moiety may contribute to its binding affinity in biological systems. Overall, this compound's unique structure positions it as a candidate for further investigation in drug development and other chemical applications.
Formula:C15H21NO4
InChI:InChI=1S/C15H21NO4/c1-19-13-4-3-11(9-14(13)20-2)10-16-7-5-12(6-8-16)15(17)18/h3-4,9,12H,5-8,10H2,1-2H3,(H,17,18)
InChI key:InChIKey=YOHPYUYEGMZQBE-UHFFFAOYSA-N
SMILES:C(C1=CC(OC)=C(OC)C=C1)N2CCC(C(O)=O)CC2
Synonyms:- 1-[(3,4-Dimethoxyphenyl)methyl]piperidine-4-carboxylic acid
- 1-(3,4-Dimethoxy-benzyl)-piperidine-4-carboxylic acid
- 4-Piperidinecarboxylic acid, 1-[(3,4-dimethoxyphenyl)methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.