CAS 856437-82-6

α-[[(2-Hydroxyphenyl)amino]methyl]-1H-indole-1-ethanol

Description:

α-[[(2-Hydroxyphenyl)amino]methyl]-1H-indole-1-ethanol, with the CAS number 856437-82-6, is a chemical compound characterized by its complex structure, which includes an indole moiety and a hydroxyl group. This compound features an amino group attached to a phenyl ring, contributing to its potential biological activity. The presence of the hydroxyl group suggests that it may engage in hydrogen bonding, influencing its solubility and reactivity. The indole structure is known for its role in various biological processes and can exhibit properties such as fluorescence and the ability to participate in electron transfer reactions. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential interactions with biological targets. Its specific characteristics, such as melting point, solubility, and stability, would depend on the conditions under which it is studied. Overall, α-[[(2-Hydroxyphenyl)amino]methyl]-1H-indole-1-ethanol represents a compound with intriguing chemical properties and potential applications in research and drug development.

Formula: C₁₇H₁₈N₂O₂

InChI: InChI=1S/C17H18N2O2/c20-14(11-18-15-6-2-4-8-17(15)21)12-19-10-9-13-5-1-3-7-16(13)19/h1-10,14,18,20-21H,11-12H2

InChI key: InChIKey=XYHIQIZXHBQQCU-UHFFFAOYSA-N

SMILES: C(C(CNC1=C(O)C=CC=C1)O)N2C=3C(C=C2)=CC=CC3

Synonyms:

• α-[[(2-Hydroxyphenyl)amino]methyl]-1H-indole-1-ethanol
• 1H-Indole-1-ethanol, α-[[(2-hydroxyphenyl)amino]methyl]-