CAS 856437-83-7

(2,2-dimethyl-3-oxopiperazin-1-yl)acetic acid

Description:

(2,2-Dimethyl-3-oxopiperazin-1-yl)acetic acid is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features a ketone functional group at the 3-position and an acetic acid moiety, contributing to its acidic properties. The presence of two methyl groups at the 2-position enhances its steric bulk and may influence its solubility and reactivity. The compound is likely to exhibit both basic and acidic characteristics due to the piperazine nitrogen atoms and the carboxylic acid group, respectively. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as piperazine derivatives are often associated with various biological activities. Additionally, the compound's unique functional groups may allow for further chemical modifications, making it a versatile intermediate in organic synthesis. As with many chemical substances, safety data and handling precautions should be considered when working with this compound in a laboratory setting.

Formula: C₈H₁₄N₂O₃

InChI: InChI=1/C8H14N2O3/c1-8(2)7(13)9-3-4-10(8)5-6(11)12/h3-5H2,1-2H3,(H,9,13)(H,11,12)

SMILES: CC1(C)C(=NCCN1CC(=O)O)O

Synonyms:

• 1-Piperazineacetic Acid, 2,2-Dimethyl-3-Oxo-
• (2,2-Dimethyl-3-oxopiperazin-1-yl)acetic acid
• (2,2-DIMETHYL-3-OXO-PIPERAZIN-1-YL)-ACETIC ACID
• CHEMBRDG-BB 4014695
• (2,2-dimethyl-3-oxopiperazin-1-yl)acetic acid(SALTDATA: HCl)
• 2-(2,2-Dimethyl-3-oxopiperazin-1-yl)acetic acid