CAS 856562-90-8

Benzenemethanamine, 4-(difluoromethoxy)-α-methyl-, hydrochloride (1:1), (αR)-

Description:

Benzenemethanamine, 4-(difluoromethoxy)-α-methyl-, hydrochloride (1:1), (αR)-, is a chemical compound characterized by its amine functional group and a substituted benzene ring. The presence of a difluoromethoxy group indicates that the compound has two fluorine atoms attached to a methoxy group, which can influence its reactivity and solubility. The α-methyl designation suggests that there is a methyl group attached to the alpha carbon of the amine, which can affect the steric and electronic properties of the molecule. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its specific stereochemistry, indicated by the (αR)- notation, suggests that it has a defined spatial arrangement, which can be crucial for its interaction with biological targets. Overall, this compound's unique structural features contribute to its potential applications in medicinal chemistry and related fields.

Formula: C₉H₁₁F₂NO·ClH

InChI: InChI=1S/C9H11F2NO.ClH/c1-6(12)7-2-4-8(5-3-7)13-9(10)11;/h2-6,9H,12H2,1H3;1H/t6-;/m1./s1

InChI key: InChIKey=BWXKCZGSVZCVQK-FYZOBXCZSA-N

SMILES: O(C(F)F)C1=CC=C([C@@H](C)N)C=C1.Cl

Synonyms:

• Benzenemethanamine, 4-(difluoromethoxy)-α-methyl-, hydrochloride, (αR)-
• Benzenemethanamine, 4-(difluoromethoxy)-α-methyl-, hydrochloride (1:1), (αR)-

(1R)-1-[4-(Difluoromethoxy)phenyl]ethan-1-amine hydrochloride

CAS: 856562-90-8

Versatile small molecule scaffold

Formula: C₉H₁₂ClF₂NO

Purity: Min. 95%

Molecular weight: 223.65 g/mol

Ref: 3D-GJB56290