CymitQuimica logo

CAS 856563-03-6

:

Benzenemethanamine, α-ethyl-2,4-dimethyl-, hydrochloride (1:1), (αR)-

Description:
Benzenemethanamine, α-ethyl-2,4-dimethyl-, hydrochloride (1:1), (αR)-, is a chemical compound characterized by its amine functional group and a substituted benzene ring. This compound features an ethyl group and two methyl groups attached to the alpha carbon of the amine, contributing to its unique structural properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in various applications, including pharmaceuticals. The (αR)- designation indicates the specific stereochemistry of the compound, which can influence its biological activity and interactions. This compound may exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can affect its reactivity and solubility. Its specific applications and effects would depend on its interaction with biological systems, making it of interest in medicinal chemistry and drug development. As with many amines, safety and handling precautions should be observed due to potential toxicity and reactivity.
Formula:C11H17N·ClH
InChI:InChI=1S/C11H17N.ClH/c1-4-11(12)10-6-5-8(2)7-9(10)3;/h5-7,11H,4,12H2,1-3H3;1H/t11-;/m1./s1
InChI key:InChIKey=IBRGHVMFMQNILO-RFVHGSKJSA-N
SMILES:[C@H](CC)(N)C1=C(C)C=C(C)C=C1.Cl
Synonyms:
  • Benzenemethanamine, α-ethyl-2,4-dimethyl-, hydrochloride, (αR)-
  • Benzenemethanamine, α-ethyl-2,4-dimethyl-, hydrochloride (1:1), (αR)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.