CAS 856563-66-1

1-(2-Chlorophenyl)cyclopentanamine

Description:

1-(2-Chlorophenyl)cyclopentanamine is an organic compound characterized by its cyclopentane structure substituted with a 2-chlorophenyl group and an amine functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, which can influence its reactivity and solubility. The presence of the chlorine atom on the phenyl ring can enhance the compound's lipophilicity and may affect its biological activity, making it of interest in medicinal chemistry. The amine group can participate in hydrogen bonding, impacting its interactions with other molecules. Additionally, the compound may exhibit specific stereochemical configurations due to the cyclopentane ring, which can influence its conformational flexibility. As with many amines, it may also display basic properties, allowing it to form salts with acids. Overall, 1-(2-Chlorophenyl)cyclopentanamine is a compound that may have applications in pharmaceuticals or as a building block in organic synthesis, although specific biological or chemical activities would require further investigation.

Formula: C₁₁H₁₄ClN

InChI: InChI=1S/C11H14ClN/c12-10-6-2-1-5-9(10)11(13)7-3-4-8-11/h1-2,5-6H,3-4,7-8,13H2

InChI key: InChIKey=KGVQTPAKGZAJNO-UHFFFAOYSA-N

SMILES: NC1(CCCC1)C2=C(Cl)C=CC=C2

Synonyms:

• 1-(2-Chlorophenyl)cyclopentan-1-amine
• Cyclopentanamine, 1-(2-chlorophenyl)-
• 1-(2-Chlorophenyl)cyclopentanamine