CymitQuimica logo

CAS 85658-55-5

:

5-bromo-4-phenylpyrimidin-2-amine

Description:
5-Bromo-4-phenylpyrimidin-2-amine is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. The presence of a bromine atom at the 5-position and a phenyl group at the 4-position contributes to its unique reactivity and potential applications in medicinal chemistry. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its structure suggests potential biological activity, making it of interest in pharmaceutical research, particularly in the development of targeted therapies. The amine functional group at the 2-position can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the compound's properties, such as melting point, boiling point, and spectral characteristics, can vary based on purity and environmental conditions. Overall, 5-bromo-4-phenylpyrimidin-2-amine serves as a valuable building block in organic synthesis and drug development.
Formula:C10H8BrN3
InChI:InChI=1/C10H8BrN3/c11-8-6-13-10(12)14-9(8)7-4-2-1-3-5-7/h1-6H,(H2,12,13,14)
SMILES:c1ccc(cc1)c1c(c[nH]c(=N)n1)Br
Synonyms:
  • 2-Pyrimidinamine, 5-Bromo-4-Phenyl-
  • 2-Amino-5-bromo-4-phenylpyrimidine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.