CAS 856600-01-6
:4-amino-5H-pyrrolo[3,2-d]pyrimidine-2-thiol sulfate (1:1)
Description:
4-Amino-5H-pyrrolo[3,2-d]pyrimidine-2-thiol sulfate (1:1) is a chemical compound characterized by its unique bicyclic structure, which incorporates both pyrrole and pyrimidine rings. This compound features an amino group and a thiol group, contributing to its reactivity and potential biological activity. The sulfate moiety indicates that it exists as a salt, which can enhance its solubility in aqueous environments. The presence of the thiol group suggests that it may participate in redox reactions and can form disulfide bonds, making it relevant in biochemical contexts. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Its CAS number, 856600-01-6, allows for precise identification and retrieval of information regarding its properties, synthesis, and applications. Overall, the structural features and functional groups of this compound suggest potential utility in various chemical and biological applications, warranting further investigation into its properties and effects.
Formula:C6H8N4O4S2
InChI:InChI=1/C6H6N4S.H2O4S/c7-5-4-3(1-2-8-4)9-6(11)10-5;1-5(2,3)4/h1-2,8H,(H3,7,9,10,11);(H2,1,2,3,4)
SMILES:c1c[nH]c2c1nc([nH]c2=N)S.OS(=O)(=O)O
Synonyms:- 5H-pyrrolo[3,2-d]pyrimidine-2-thiol, 4-amino-, sulfate (1:1)
- 4-Amino-7H-pyrrolo[2,3-d]pyrimidine Hydrogen Sulfate
- 4-Amino-7H-pyrrolo[2,3-d]pyrimidine Sulfate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
