CAS 856602-44-3

β-Amino-6-quinolinepropanol

Description:

β-Amino-6-quinolinepropanol is a chemical compound characterized by its unique structure, which includes a quinoline ring system and an amino alcohol functional group. This compound typically exhibits properties associated with both the quinoline moiety and the amino alcohol, such as potential biological activity and solubility in polar solvents. The presence of the amino group suggests that it may participate in hydrogen bonding, influencing its reactivity and interaction with biological targets. Additionally, the quinoline structure is known for its role in various pharmacological applications, including antimicrobial and antimalarial activities. The specific stereochemistry and substituents on the quinoline and propanol portions can significantly affect the compound's properties, including its pharmacokinetics and pharmacodynamics. As with many organic compounds, β-Amino-6-quinolinepropanol may also exhibit varying degrees of stability under different environmental conditions, making it important to consider its storage and handling requirements in laboratory settings. Overall, this compound represents a fascinating intersection of organic chemistry and medicinal applications.

Formula: C₁₂H₁₄N₂O

InChI: InChI=1S/C12H14N2O/c13-11(8-15)7-9-3-4-12-10(6-9)2-1-5-14-12/h1-6,11,15H,7-8,13H2

InChI key: InChIKey=HTNKMYOVYSAMTJ-UHFFFAOYSA-N

SMILES: C(C(CO)N)C1=CC2=C(C=C1)N=CC=C2

Synonyms:

• 2-Amino-3-(quinolin-6-yl)propan-1-ol
• 6-Quinolinepropanol, β-amino-
• β-Amino-6-quinolinepropanol