CymitQuimica logo

CAS 856627-47-9

:

3-(azepan-1-yl)butanoic acid

Description:
3-(Azepan-1-yl)butanoic acid is an organic compound characterized by its structure, which includes a butanoic acid moiety and an azepane ring. The azepane ring, a seven-membered saturated nitrogen-containing heterocycle, contributes to the compound's unique properties, including its potential for forming hydrogen bonds and its influence on solubility and reactivity. The presence of the carboxylic acid functional group (-COOH) imparts acidic characteristics, allowing the compound to participate in various chemical reactions, such as esterification and amidation. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, the compound's solubility and stability can be influenced by factors such as pH and temperature, which are important considerations in both laboratory and pharmaceutical contexts. Overall, 3-(azepan-1-yl)butanoic acid represents a versatile chemical entity with potential applications in various fields of chemistry and biology.
Formula:C10H19NO2
InChI:InChI=1/C10H19NO2/c1-9(8-10(12)13)11-6-4-2-3-5-7-11/h9H,2-8H2,1H3,(H,12,13)
SMILES:CC(CC(=O)O)N1CCCCCC1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.