CAS 856646-02-1

Benzenemethanamine, α-ethyl-4-methyl-, hydrochloride (1:1), (αR)-

Description:

Benzenemethanamine, α-ethyl-4-methyl-, hydrochloride (1:1), (αR)-, also known by its CAS number 856646-02-1, is a chemical compound characterized by its amine functional group and aromatic structure. This compound features a benzene ring substituted with an ethyl group and a methyl group, contributing to its unique properties. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its stability and solubility in aqueous solutions. The presence of the amine group suggests that it may exhibit basic properties, allowing it to participate in various chemical reactions, including protonation. Its stereochemistry, indicated by the (αR)- designation, implies a specific three-dimensional arrangement of atoms, which can influence its biological activity and interactions. This compound may be of interest in pharmaceutical research and development, particularly in the synthesis of biologically active molecules or as a potential therapeutic agent. However, detailed safety and handling information should be consulted, as with any chemical substance.

Formula: C₁₀H₁₅N·ClH

InChI: InChI=1S/C10H15N.ClH/c1-3-10(11)9-6-4-8(2)5-7-9;/h4-7,10H,3,11H2,1-2H3;1H/t10-;/m1./s1

InChI key: InChIKey=XKTMBXZLOUIZLE-HNCPQSOCSA-N

SMILES: [C@H](CC)(N)C1=CC=C(C)C=C1.Cl

Synonyms:

• Benzenemethanamine, α-ethyl-4-methyl-, hydrochloride, (αR)-
• Benzenemethanamine, α-ethyl-4-methyl-, hydrochloride (1:1), (αR)-

(R)-1-(p-Tolyl)propan-1-amine hydrochloride

CAS: 856646-02-1

(R)-1-(p-Tolyl)propan-1-amine hydrochloride

Purity: 98%

Molecular weight: 185.69g/mol

Ref: 54-OR85072