CAS 856646-07-6
:Benzenemethanamine, α,2,5-trimethyl-, hydrochloride (1:1), (αR)-
Description:
Benzenemethanamine, α,2,5-trimethyl-, hydrochloride (1:1), (αR)-, is a chemical compound characterized by its amine functional group and a benzene ring structure. This compound features a trimethyl substitution pattern on the alpha carbon, which influences its steric and electronic properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The (αR)- designation indicates the specific stereochemistry of the molecule, which can significantly affect its biological activity and interaction with receptors. The presence of the amine group suggests potential for hydrogen bonding, which can play a role in its reactivity and solubility. Overall, this compound may be of interest in medicinal chemistry and research due to its structural characteristics and potential pharmacological properties.
Formula:C10H15N·ClH
InChI:InChI=1S/C10H15N.ClH/c1-7-4-5-8(2)10(6-7)9(3)11;/h4-6,9H,11H2,1-3H3;1H/t9-;/m1./s1
InChI key:InChIKey=XQDCTHGENBYORR-SBSPUUFOSA-N
SMILES:[C@H](C)(N)C1=C(C)C=CC(C)=C1.Cl
Synonyms:- Benzenemethanamine, α,2,5-trimethyl-, hydrochloride (1:1), (αR)-
- Benzenemethanamine, α,2,5-trimethyl-, hydrochloride, (αR)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
