CAS 85665-59-4

1-(Chlorocarbonyl)-L-proline methyl ester

Description:

1-(Chlorocarbonyl)-L-proline methyl ester, with the CAS number 85665-59-4, is an organic compound characterized by its unique functional groups and structural features. It contains a proline backbone, which is an amino acid known for its cyclic structure and role in protein synthesis. The presence of a chlorocarbonyl group indicates that it has a carbonyl (C=O) functional group bonded to a chlorine atom, making it a reactive acyl chloride derivative. This compound is typically used in organic synthesis, particularly in the preparation of various pharmaceuticals and bioactive molecules due to its ability to participate in nucleophilic acyl substitution reactions. Its methyl ester form suggests that it has a methoxy group (-OCH3) attached to the carboxylic acid moiety, which can influence its solubility and reactivity. Overall, 1-(Chlorocarbonyl)-L-proline methyl ester is a valuable intermediate in chemical synthesis, with applications in medicinal chemistry and the development of novel compounds.

Formula: C₇H₁₀ClNO₃

InChI: InChI=1S/C7H10ClNO3/c1-12-6(10)5-3-2-4-9(5)7(8)11/h5H,2-4H2,1H3/t5-/m0/s1

InChI key: InChIKey=YUCJQEDFNSFKNN-YFKPBYRVSA-N

SMILES: C(OC)(=O)[C@H]1N(C(Cl)=O)CCC1

Synonyms:

• Methyl 1-(chlorocarbonyl)-L-prolinate
• N-Chlorocarbonyl-L-proline methyl ester
• 1-(Chlorocarbonyl)-L-proline methyl ester
• L-Proline, 1-(chlorocarbonyl)-, methyl ester
• Methyl (S)-1-(chlorocarbonyl)pyrrolidine-2-carboxylate

(S)-Methyl 1-(chlorocarbonyl)pyrrolidine-2-carboxylate

CAS: 85665-59-4

Versatile small molecule scaffold

Formula: C₇H₁₀ClNO₃

Purity: Min. 95%

Molecular weight: 191.61 g/mol

Ref: 3D-KDA66559