
CAS 85665-60-7
:3-(1,1-Dimethylethyl)-5-(hydroxymethyl)-2-oxazolidinone
Description:
3-(1,1-Dimethylethyl)-5-(hydroxymethyl)-2-oxazolidinone, with the CAS number 85665-60-7, is a chemical compound characterized by its oxazolidinone structure, which features a five-membered ring containing both nitrogen and oxygen atoms. This compound typically exhibits properties such as being a white to off-white solid, and it is soluble in polar solvents like water and alcohols, which is indicative of its functional groups. The presence of the hydroxymethyl group contributes to its reactivity and potential applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Additionally, the bulky tert-butyl group (1,1-dimethylethyl) can influence the compound's steric properties, potentially affecting its biological activity and interactions with other molecules. Overall, this compound is of interest in various fields, including medicinal chemistry, due to its unique structural features and potential utility in synthesizing more complex chemical entities.
Formula:C8H15NO3
InChI:InChI=1S/C8H15NO3/c1-8(2,3)9-4-6(5-10)12-7(9)11/h6,10H,4-5H2,1-3H3
InChI key:InChIKey=SSMIUHOOMMVZNL-UHFFFAOYSA-N
SMILES:C(C)(C)(C)N1CC(CO)OC1=O
Synonyms:- 3-(1,1-Dimethylethyl)-5-(hydroxymethyl)-2-oxazolidinone
- 2-Oxazolidinone, 3-(1,1-dimethylethyl)-5-(hydroxymethyl)-
- 3-tert-Butyl-5-(hydroxymethyl)-1,3-oxazolidin-2-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.