CAS 85665-75-4

3-[4-(Dimethylamino)phenoxy]-1-propanol

Description:

3-[4-(Dimethylamino)phenoxy]-1-propanol, with the CAS number 85665-75-4, is an organic compound characterized by its structure, which includes a propanol backbone and a dimethylamino group attached to a phenoxy moiety. This compound typically exhibits properties such as being a colorless to pale yellow liquid or solid, depending on its form and purity. It is soluble in polar solvents like water and alcohols, which is indicative of its functional groups. The presence of the dimethylamino group suggests potential basicity and reactivity, making it useful in various chemical applications, including as an intermediate in the synthesis of pharmaceuticals or agrochemicals. Additionally, the phenoxy group can contribute to its biological activity, potentially influencing its interaction with biological systems. Safety data should be consulted for handling and exposure guidelines, as compounds with amine functionalities can exhibit varying degrees of toxicity and reactivity. Overall, this compound's unique structure and properties make it a subject of interest in both research and industrial applications.

Formula: C₁₁H₁₇NO₂

InChI: InChI=1S/C11H17NO2/c1-12(2)10-4-6-11(7-5-10)14-9-3-8-13/h4-7,13H,3,8-9H2,1-2H3

InChI key: InChIKey=YCHMEDYYCJZHFH-UHFFFAOYSA-N

SMILES: O(CCCO)C1=CC=C(N(C)C)C=C1

Synonyms:

• 3-[4-(Dimethylamino)phenoxy]-1-propanol
• 1-Propanol, 3-[4-(dimethylamino)phenoxy]-