CAS 856696-08-7
:5-Ethyl-3-thiophenemethanamine
Description:
5-Ethyl-3-thiophenemethanamine, identified by its CAS number 856696-08-7, is an organic compound characterized by the presence of a thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. This compound features an ethyl group and an amine functional group, contributing to its potential as a building block in organic synthesis and medicinal chemistry. The thiophene moiety often imparts unique electronic properties, making it useful in various applications, including pharmaceuticals and agrochemicals. The amine group can participate in hydrogen bonding and nucleophilic reactions, enhancing its reactivity. Additionally, the presence of the ethyl substituent can influence the compound's solubility and lipophilicity, which are critical factors in drug design. Overall, 5-Ethyl-3-thiophenemethanamine exhibits characteristics typical of compounds with aromatic and amine functionalities, making it a subject of interest in chemical research and development.
Formula:C7H11NS
InChI:InChI=1S/C7H11NS/c1-2-7-3-6(4-8)5-9-7/h3,5H,2,4,8H2,1H3
InChI key:InChIKey=QXXXWSZQOSBYKB-UHFFFAOYSA-N
SMILES:C(N)C=1C=C(CC)SC1
Synonyms:- (5-Ethylthiophen-3-yl)methanamine
- [(5-Ethyl-3-thienyl)methyl]amine
- 3-Thiophenemethanamine, 5-ethyl-
- 5-Ethyl-3-thiophenemethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.